About 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide
4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide (PubChem CID 16742235) has the molecular formula C24H16N6O4
and a molecular weight of 452.43 g/mol. Its IUPAC name is 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide.
Molecular Properties
| Compound Name | 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide |
| PubChem CID | 16742235 |
| Molecular Formula | C24H16N6O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide |
| SMILES | COc1c(C(=O)N=[N+]=[N-])cc2ccccc2c1-c1c(OC)c(C(=O)N=[N+]=[N-])cc2ccccc12 |
| InChI | InChI=1S/C24H16N6O4/c1-33-21-17(23(31)27-29-25)11-13-7-3-5-9-15(13)19(21)20-16-10-6-4-8-14(16)12-18(22(20)34-2)24(32)28-30-26/h3-12H,1-2H3 |
| InChIKey | IMMOIZNOOHDADJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 150.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide?
The IUPAC name of 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide (CID 16742235) is 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide.
What is the SMILES notation for 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide?
The canonical SMILES for 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide is COc1c(C(=O)N=[N+]=[N-])cc2ccccc2c1-c1c(OC)c(C(=O)N=[N+]=[N-])cc2ccccc12.
What is the InChIKey of 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide?
The InChIKey is IMMOIZNOOHDADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N6O4/c1-33-21-17(23(31)27-29-25)11-13-7-3-5-9-15(13)19(21)20-16-10-6-4-8-14(16)12-18(22(20)34-2)24(32)28-30-26/h3-12H,1-2H3.
What are the key properties of 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide?
4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide has a molecular weight of 452.43 g/mol, XLogP of 6.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-carbonazidoyl-2-methoxynaphthalen-1-yl)-3-methoxynaphthalene-2-carbonyl azide is sourced from PubChem (CID 16742235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).