C14H11N3O3 — CID 142821860
4-hydroxy-3,4-dihydro-2H-benzo[h]chromene-6-carbonyl azide (PubChem CID 142821860) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-hydroxy-3,4-dihydro-2H-benzo[h]chromene-6-carbonyl azide.
| Compound Name | 4-hydroxy-3,4-dihydro-2H-benzo[h]chromene-6-carbonyl azide |
|---|---|
| PubChem CID | 142821860 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-hydroxy-3,4-dihydro-2H-benzo[h]chromene-6-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1cc2c(c3ccccc13)OCCC2O |
| InChI | InChI=1S/C14H11N3O3/c15-17-16-14(19)10-7-11-12(18)5-6-20-13(11)9-4-2-1-3-8(9)10/h1-4,7,12,18H,5-6H2 |
| InChIKey | SJJNHRKHPAMRLA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|