About 2,3-difluorobenzoyl azide
2,3-difluorobenzoyl azide (PubChem CID 62661740) has the molecular formula C7H3F2N3O
and a molecular weight of 183.12 g/mol. Its IUPAC name is 2,3-difluorobenzoyl azide.
Molecular Properties
| Compound Name | 2,3-difluorobenzoyl azide |
| PubChem CID | 62661740 |
| Molecular Formula | C7H3F2N3O |
| Molecular Weight | 183.12 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2,3-difluorobenzoyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C7H3F2N3O/c8-5-3-1-2-4(6(5)9)7(13)11-12-10/h1-3H |
| InChIKey | NTCJDTKCCFPYQR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2,3-difluorobenzoyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluorobenzoyl azide?
The IUPAC name of 2,3-difluorobenzoyl azide (CID 62661740) is 2,3-difluorobenzoyl azide.
What is the SMILES notation for 2,3-difluorobenzoyl azide?
The canonical SMILES for 2,3-difluorobenzoyl azide is [N-]=[N+]=NC(=O)c1cccc(F)c1F.
What is the InChIKey of 2,3-difluorobenzoyl azide?
The InChIKey is NTCJDTKCCFPYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F2N3O/c8-5-3-1-2-4(6(5)9)7(13)11-12-10/h1-3H.
What are the key properties of 2,3-difluorobenzoyl azide?
2,3-difluorobenzoyl azide has a molecular weight of 183.12 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluorobenzoyl azide is sourced from PubChem (CID 62661740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).