C21H28ClN5 — CID 143411427
5-[1-(3-chlorophenyl)triazol-4-yl]-4-methyl-1-[(1E)-2-methylbuta-1,3-dienyl]-1,4-diazonane (PubChem CID 143411427) has the molecular formula C21H28ClN5 and a molecular weight of 385.94 g/mol. Its IUPAC name is 5-[1-(3-chlorophenyl)triazol-4-yl]-4-methyl-1-[(1E)-2-methylbuta-1,3-dienyl]-1,4-diazonane.
| Compound Name | 5-[1-(3-chlorophenyl)triazol-4-yl]-4-methyl-1-[(1E)-2-methylbuta-1,3-dienyl]-1,4-diazonane |
|---|---|
| PubChem CID | 143411427 |
| Molecular Formula | C21H28ClN5 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-[1-(3-chlorophenyl)triazol-4-yl]-4-methyl-1-[(1E)-2-methylbuta-1,3-dienyl]-1,4-diazonane |
| SMILES | C=C/C(C)=C/N1CCCCC(c2cn(-c3cccc(Cl)c3)nn2)N(C)CC1 |
| InChI | InChI=1S/C21H28ClN5/c1-4-17(2)15-26-11-6-5-10-21(25(3)12-13-26)20-16-27(24-23-20)19-9-7-8-18(22)14-19/h4,7-9,14-16,21H,1,5-6,10-13H2,2-3H3/b17-15+ |
| InChIKey | DJQNONYRJZALIX-BMRADRMJSA-N |
| XLogP | 4.47 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|