C17H29NO2 — CID 143411995
cis-(1S,2E,4R)-2-[(E)-2-methoxypent-2-enylidene]-3-methylidene-4-prop-2-enoxycyclopentan-1-amine;ethane (PubChem CID 143411995) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is cis-(1S,2E,4R)-2-[(E)-2-methoxypent-2-enylidene]-3-methylidene-4-prop-2-enoxycyclopentan-1-amine;ethane.
| Compound Name | cis-(1S,2E,4R)-2-[(E)-2-methoxypent-2-enylidene]-3-methylidene-4-prop-2-enoxycyclopentan-1-amine;ethane |
|---|---|
| PubChem CID | 143411995 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | cis-(1S,2E,4R)-2-[(E)-2-methoxypent-2-enylidene]-3-methylidene-4-prop-2-enoxycyclopentan-1-amine;ethane |
| SMILES | C=CCO[C@@H]1C[C@H](N)/C(=C/C(=C\CC)OC)C1=C.CC |
| InChI | InChI=1S/C15H23NO2.C2H6/c1-5-7-12(17-4)9-13-11(3)15(10-14(13)16)18-8-6-2;1-2/h6-7,9,14-15H,2-3,5,8,10,16H2,1,4H3;1-2H3/b12-7+,13-9+;/t14-,15+;/m0./s1 |
| InChIKey | IVGBRKXYLUERLU-AMVMIKFCSA-N |
| XLogP | 3.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|