C7H11N3 — CID 143413696
1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole (PubChem CID 143413696) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole.
| Compound Name | 1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 143413696 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole |
| SMILES | C/C=C\C(C)n1cncn1 |
| InChI | InChI=1S/C7H11N3/c1-3-4-7(2)10-6-8-5-9-10/h3-7H,1-2H3/b4-3- |
| InChIKey | SNGQGBNNTYWLRI-ARJAWSKDSA-N |
| XLogP | 1.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|