C8H10N4 — CID 58270149
1-[1-(2H-pyrrol-5-yl)ethyl]-1,2,4-triazole (PubChem CID 58270149) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 1-[1-(2H-pyrrol-5-yl)ethyl]-1,2,4-triazole.
| Compound Name | 1-[1-(2H-pyrrol-5-yl)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 58270149 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-[1-(2H-pyrrol-5-yl)ethyl]-1,2,4-triazole |
| SMILES | CC(C1=NCC=C1)n1cncn1 |
| InChI | InChI=1S/C8H10N4/c1-7(8-3-2-4-10-8)12-6-9-5-11-12/h2-3,5-7H,4H2,1H3 |
| InChIKey | XGGNVZHJESZQMY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |