C12H12N4 — CID 163719210
3-ethyl-4-(1,2,4-triazol-1-yl)-2H-indole (PubChem CID 163719210) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 3-ethyl-4-(1,2,4-triazol-1-yl)-2H-indole.
| Compound Name | 3-ethyl-4-(1,2,4-triazol-1-yl)-2H-indole |
|---|---|
| PubChem CID | 163719210 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-ethyl-4-(1,2,4-triazol-1-yl)-2H-indole |
| SMILES | CCC1=c2c(-n3cncn3)cccc2=NC1 |
| InChI | InChI=1S/C12H12N4/c1-2-9-6-14-10-4-3-5-11(12(9)10)16-8-13-7-15-16/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | KQAYJLDWPHDCQA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |