C8H9N3 — CID 124638455
1-[(1R)-cyclohexa-2,4-dien-1-yl]-1,2,4-triazole (PubChem CID 124638455) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-[(1R)-cyclohexa-2,4-dien-1-yl]-1,2,4-triazole.
| Compound Name | 1-[(1R)-cyclohexa-2,4-dien-1-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 124638455 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1-[(1R)-cyclohexa-2,4-dien-1-yl]-1,2,4-triazole |
| SMILES | C1=CC[C@@H](n2cncn2)C=C1 |
| InChI | InChI=1S/C8H9N3/c1-2-4-8(5-3-1)11-7-9-6-10-11/h1-4,6-8H,5H2/t8-/m0/s1 |
| InChIKey | IXWYHSNTJAYUNU-QMMMGPOBSA-N |
| XLogP | 1.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |