C20H20N6O2 — CID 143416898
3-[[(6-aminopyrimidin-4-yl)-methylcarbamoyl]amino]-4-methyl-N-phenylbenzamide (PubChem CID 143416898) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[[(6-aminopyrimidin-4-yl)-methylcarbamoyl]amino]-4-methyl-N-phenylbenzamide.
| Compound Name | 3-[[(6-aminopyrimidin-4-yl)-methylcarbamoyl]amino]-4-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 143416898 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[[(6-aminopyrimidin-4-yl)-methylcarbamoyl]amino]-4-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2)cc1NC(=O)N(C)c1cc(N)ncn1 |
| InChI | InChI=1S/C20H20N6O2/c1-13-8-9-14(19(27)24-15-6-4-3-5-7-15)10-16(13)25-20(28)26(2)18-11-17(21)22-12-23-18/h3-12H,1-2H3,(H,24,27)(H,25,28)(H2,21,22,23) |
| InChIKey | HEHFAVPXPSBDEL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |