C21H16F5N5O3 — CID 89371483
(2,3,4,5,6-pentafluorophenyl) 4-methyl-3-[[methyl-[6-(methylamino)pyrimidin-4-yl]carbamoyl]amino]benzoate (PubChem CID 89371483) has the molecular formula C21H16F5N5O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-methyl-3-[[methyl-[6-(methylamino)pyrimidin-4-yl]carbamoyl]amino]benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-methyl-3-[[methyl-[6-(methylamino)pyrimidin-4-yl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 89371483 |
| Molecular Formula | C21H16F5N5O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-methyl-3-[[methyl-[6-(methylamino)pyrimidin-4-yl]carbamoyl]amino]benzoate |
| SMILES | CNc1cc(N(C)C(=O)Nc2cc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc2C)ncn1 |
| InChI | InChI=1S/C21H16F5N5O3/c1-9-4-5-10(20(32)34-19-17(25)15(23)14(22)16(24)18(19)26)6-11(9)30-21(33)31(3)13-7-12(27-2)28-8-29-13/h4-8H,1-3H3,(H,30,33)(H,27,28,29) |
| InChIKey | UCSXPMXVAKZGHV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|