About (4S)-2,4-dimethyloxane;ethene
(4S)-2,4-dimethyloxane;ethene (PubChem CID 143417606) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is (4S)-2,4-dimethyloxane;ethene.
Molecular Properties
| Compound Name | (4S)-2,4-dimethyloxane;ethene |
| PubChem CID | 143417606 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (4S)-2,4-dimethyloxane;ethene |
| SMILES | C=C.CC1C[C@@H](C)CCO1 |
| InChI | InChI=1S/C7H14O.C2H4/c1-6-3-4-8-7(2)5-6;1-2/h6-7H,3-5H2,1-2H3;1-2H2/t6-,7?;/m0./s1 |
| InChIKey | GUIYYPZWGZHBQL-OXIGJRIQSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,4-dimethyloxane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,4-dimethyloxane;ethene?
The IUPAC name of (4S)-2,4-dimethyloxane;ethene (CID 143417606) is (4S)-2,4-dimethyloxane;ethene.
What is the SMILES notation for (4S)-2,4-dimethyloxane;ethene?
The canonical SMILES for (4S)-2,4-dimethyloxane;ethene is C=C.CC1C[C@@H](C)CCO1.
What is the InChIKey of (4S)-2,4-dimethyloxane;ethene?
The InChIKey is GUIYYPZWGZHBQL-OXIGJRIQSA-N. The full InChI is InChI=1S/C7H14O.C2H4/c1-6-3-4-8-7(2)5-6;1-2/h6-7H,3-5H2,1-2H3;1-2H2/t6-,7?;/m0./s1.
What are the key properties of (4S)-2,4-dimethyloxane;ethene?
(4S)-2,4-dimethyloxane;ethene has a molecular weight of 142.24 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,4-dimethyloxane;ethene is sourced from PubChem (CID 143417606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).