C16H29F2NOS — CID 143418282
ethane;1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine;methanol (PubChem CID 143418282) has the molecular formula C16H29F2NOS and a molecular weight of 321.48 g/mol. Its IUPAC name is ethane;1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine;methanol.
| Compound Name | ethane;1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine;methanol |
|---|---|
| PubChem CID | 143418282 |
| Molecular Formula | C16H29F2NOS |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | ethane;1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine;methanol |
| SMILES | CC.CO.NC(CF)CC1=CC=CC(SCCCF)C=C1 |
| InChI | InChI=1S/C13H19F2NS.C2H6.CH4O/c14-7-2-8-17-13-4-1-3-11(5-6-13)9-12(16)10-15;2*1-2/h1,3-6,12-13H,2,7-10,16H2;1-2H3;2H,1H3 |
| InChIKey | VWXBMEUQRHEYQU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|