C13H19F2NS — CID 143418283
1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine (PubChem CID 143418283) has the molecular formula C13H19F2NS and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine.
| Compound Name | 1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 143418283 |
| Molecular Formula | C13H19F2NS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-fluoro-3-[5-(3-fluoropropylsulfanyl)cyclohepta-1,3,6-trien-1-yl]propan-2-amine |
| SMILES | NC(CF)CC1=CC=CC(SCCCF)C=C1 |
| InChI | InChI=1S/C13H19F2NS/c14-7-2-8-17-13-4-1-3-11(5-6-13)9-12(16)10-15/h1,3-6,12-13H,2,7-10,16H2 |
| InChIKey | YBXPVPGHKQVXLQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|