C10H14FNS — CID 163602540
5-[(1E)-2-fluorobuta-1,3-dienyl]-2,4-dimethyl-2,3-dihydrothiophen-3-amine (PubChem CID 163602540) has the molecular formula C10H14FNS and a molecular weight of 199.29 g/mol. Its IUPAC name is 5-[(1E)-2-fluorobuta-1,3-dienyl]-2,4-dimethyl-2,3-dihydrothiophen-3-amine.
| Compound Name | 5-[(1E)-2-fluorobuta-1,3-dienyl]-2,4-dimethyl-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 163602540 |
| Molecular Formula | C10H14FNS |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-[(1E)-2-fluorobuta-1,3-dienyl]-2,4-dimethyl-2,3-dihydrothiophen-3-amine |
| SMILES | C=C/C(F)=C\C1=C(C)C(N)C(C)S1 |
| InChI | InChI=1S/C10H14FNS/c1-4-8(11)5-9-6(2)10(12)7(3)13-9/h4-5,7,10H,1,12H2,2-3H3/b8-5+ |
| InChIKey | GYWSOZFEZLKDOV-VMPITWQZSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|