About 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine
6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine (PubChem CID 167506405) has the molecular formula C9H12FNS
and a molecular weight of 185.27 g/mol. Its IUPAC name is 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine.
Analyze 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine?
The IUPAC name of 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine (CID 167506405) is 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine.
What is the SMILES notation for 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine?
The canonical SMILES for 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine is NC1CCSC2=C1C=C(F)CC2.
What is the InChIKey of 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine?
The InChIKey is YTHAFEWZIVFRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNS/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h5,8H,1-4,11H2.
What are the key properties of 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine?
6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine has a molecular weight of 185.27 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,4,7,8-tetrahydro-2H-thiochromen-4-amine is sourced from PubChem (CID 167506405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).