C17H29NS — CID 143703342
1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine (PubChem CID 143703342) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is 1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine.
| Compound Name | 1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 143703342 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-(4-hept-6-enylsulfanyl-2-methylcyclohexa-1,5-dien-1-yl)propan-2-amine |
| SMILES | C=CCCCCCSC1C=CC(CC(C)N)=C(C)C1 |
| InChI | InChI=1S/C17H29NS/c1-4-5-6-7-8-11-19-17-10-9-16(13-15(3)18)14(2)12-17/h4,9-10,15,17H,1,5-8,11-13,18H2,2-3H3 |
| InChIKey | BJYPONMMKIDGKR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|