C9H17NS — CID 90429877
(Z,3S)-4-methylidene-1-methylsulfanylhept-5-en-3-amine (PubChem CID 90429877) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is (Z,3S)-4-methylidene-1-methylsulfanylhept-5-en-3-amine.
| Compound Name | (Z,3S)-4-methylidene-1-methylsulfanylhept-5-en-3-amine |
|---|---|
| PubChem CID | 90429877 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (Z,3S)-4-methylidene-1-methylsulfanylhept-5-en-3-amine |
| SMILES | C=C(/C=C\C)[C@@H](N)CCSC |
| InChI | InChI=1S/C9H17NS/c1-4-5-8(2)9(10)6-7-11-3/h4-5,9H,2,6-7,10H2,1,3H3/b5-4-/t9-/m0/s1 |
| InChIKey | YLQFZNLUVNXYTO-WBSSQXGSSA-N |
| XLogP | 2.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|