C23H38ClN3O4 — CID 143418676
ethane;methyl (5E)-2-[(2-amino-3,3-dimethylbutanoyl)-ethylamino]-5-(3-chlorophenyl)-5-methoxyiminopentanoate (PubChem CID 143418676) has the molecular formula C23H38ClN3O4 and a molecular weight of 456.03 g/mol. Its IUPAC name is ethane;methyl (5E)-2-[(2-amino-3,3-dimethylbutanoyl)-ethylamino]-5-(3-chlorophenyl)-5-methoxyiminopentanoate.
| Compound Name | ethane;methyl (5E)-2-[(2-amino-3,3-dimethylbutanoyl)-ethylamino]-5-(3-chlorophenyl)-5-methoxyiminopentanoate |
|---|---|
| PubChem CID | 143418676 |
| Molecular Formula | C23H38ClN3O4 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | ethane;methyl (5E)-2-[(2-amino-3,3-dimethylbutanoyl)-ethylamino]-5-(3-chlorophenyl)-5-methoxyiminopentanoate |
| SMILES | CC.CCN(C(=O)C(N)C(C)(C)C)C(CC/C(=N\OC)c1cccc(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C21H32ClN3O4.C2H6/c1-7-25(19(26)18(23)21(2,3)4)17(20(27)28-5)12-11-16(24-29-6)14-9-8-10-15(22)13-14;1-2/h8-10,13,17-18H,7,11-12,23H2,1-6H3;1-2H3/b24-16+; |
| InChIKey | MBHDAHMPLYQECR-RSOFWHLMSA-N |
| XLogP | 4.26 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|