C34H51NO8 — CID 143419375
[2-(11-hydroxy-9,10,13,16-tetramethyl-3-methylidene-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5-nitrosooxypentanoate;pentanoic acid (PubChem CID 143419375) has the molecular formula C34H51NO8 and a molecular weight of 601.78 g/mol. Its IUPAC name is [2-(11-hydroxy-9,10,13,16-tetramethyl-3-methylidene-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5-nitrosooxypentanoate;pentanoic acid.
| Compound Name | [2-(11-hydroxy-9,10,13,16-tetramethyl-3-methylidene-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5-nitrosooxypentanoate;pentanoic acid |
|---|---|
| PubChem CID | 143419375 |
| Molecular Formula | C34H51NO8 |
| Molecular Weight | 601.78 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | [2-(11-hydroxy-9,10,13,16-tetramethyl-3-methylidene-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5-nitrosooxypentanoate;pentanoic acid |
| SMILES | C=C1C=CC2(C)C(=C1)CCC1C3CC(C)C(C(=O)COC(=O)CCCCON=O)C3(C)CC(O)C12C.CCCCC(=O)O |
| InChI | InChI=1S/C29H41NO6.C5H10O2/c1-18-11-12-28(4)20(14-18)9-10-21-22-15-19(2)26(27(22,3)16-24(32)29(21,28)5)23(31)17-35-25(33)8-6-7-13-36-30-34;1-2-3-4-5(6)7/h11-12,14,19,21-22,24,26,32H,1,6-10,13,15-17H2,2-5H3;2-4H2,1H3,(H,6,7) |
| InChIKey | OKGDDEKKYSRQSF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.78 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|