C24H34O3 — CID 143419658
2,2,10',13',16'-pentamethylspiro[1,3-dioxolane-4,17'-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-3'-one (PubChem CID 143419658) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 2,2,10',13',16'-pentamethylspiro[1,3-dioxolane-4,17'-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-3'-one.
| Compound Name | 2,2,10',13',16'-pentamethylspiro[1,3-dioxolane-4,17'-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-3'-one |
|---|---|
| PubChem CID | 143419658 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2,2,10',13',16'-pentamethylspiro[1,3-dioxolane-4,17'-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-3'-one |
| SMILES | CC1CC2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C12COC(C)(C)O2 |
| InChI | InChI=1S/C24H34O3/c1-15-12-20-18-7-6-16-13-17(25)8-10-22(16,4)19(18)9-11-23(20,5)24(15)14-26-21(2,3)27-24/h9,13,15,18,20H,6-8,10-12,14H2,1-5H3 |
| InChIKey | WOXRXMLFBYEMFS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|