C22H32O4 — CID 143419709
(9R)-8-[(8aR)-1,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl]-9-(hydroxymethyl)-9-methyl-1-oxaspiro[4.4]nonan-2-one (PubChem CID 143419709) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (9R)-8-[(8aR)-1,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl]-9-(hydroxymethyl)-9-methyl-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (9R)-8-[(8aR)-1,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl]-9-(hydroxymethyl)-9-methyl-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 143419709 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (9R)-8-[(8aR)-1,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl]-9-(hydroxymethyl)-9-methyl-1-oxaspiro[4.4]nonan-2-one |
| SMILES | CC1C(C2CCC3(CCC(=O)O3)[C@@]2(C)CO)CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C22H32O4/c1-14-17(5-4-15-12-16(24)6-9-20(14,15)2)18-7-10-22(21(18,3)13-23)11-8-19(25)26-22/h12,14,17-18,23H,4-11,13H2,1-3H3/t14?,17?,18?,20-,21+,22?/m1/s1 |
| InChIKey | MQGAKNHVKGOKEM-NIRGEGHOSA-N |
| XLogP | 3.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |