C34H50N2O10 — CID 143420147
[(4E,6Z,10E)-9-carbamoyloxy-22-formyloxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-20-yl] formate;ethane (PubChem CID 143420147) has the molecular formula C34H50N2O10 and a molecular weight of 646.78 g/mol. Its IUPAC name is [(4E,6Z,10E)-9-carbamoyloxy-22-formyloxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-20-yl] formate;ethane.
| Compound Name | [(4E,6Z,10E)-9-carbamoyloxy-22-formyloxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-20-yl] formate;ethane |
|---|---|
| PubChem CID | 143420147 |
| Molecular Formula | C34H50N2O10 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | [(4E,6Z,10E)-9-carbamoyloxy-22-formyloxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-20-yl] formate;ethane |
| SMILES | CC.COC1CC(C)C(OC)c2cc(OC=O)cc(c2OC=O)NC(=O)/C(C)=C/C=C\C(C)C(OC(N)=O)/C(C)=C/C(C)C1OC |
| InChI | InChI=1S/C32H44N2O10.C2H6/c1-18-10-9-11-19(2)31(37)34-25-15-23(42-16-35)14-24(30(25)43-17-36)28(40-7)22(5)13-26(39-6)29(41-8)21(4)12-20(3)27(18)44-32(33)38;1-2/h9-12,14-18,21-22,26-29H,13H2,1-8H3,(H2,33,38)(H,34,37);1-2H3/b10-9-,19-11+,20-12+; |
| InChIKey | PXBLDQXEGMRCBF-KTYQRIKFSA-N |
| XLogP | 5.66 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|