C30H44N2O8 — CID 162989551
[(4E,6Z,8S,10E,12S,13R,14S,16S,17R)-20,22-dihydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate (PubChem CID 162989551) has the molecular formula C30H44N2O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is [(4E,6Z,8S,10E,12S,13R,14S,16S,17R)-20,22-dihydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,8S,10E,12S,13R,14S,16S,17R)-20,22-dihydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 162989551 |
| Molecular Formula | C30H44N2O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | [(4E,6Z,8S,10E,12S,13R,14S,16S,17R)-20,22-dihydroxy-13,14,17-trimethoxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
| SMILES | CO[C@H]1[C@@H](OC)C[C@H](C)[C@@H](OC)c2cc(O)cc(c2O)NC(=O)/C(C)=C/C=C\[C@H](C)C(OC(N)=O)/C(C)=C/[C@@H]1C |
| InChI | InChI=1S/C30H44N2O8/c1-16-10-9-11-17(2)29(35)32-23-15-21(33)14-22(25(23)34)27(38-7)20(5)13-24(37-6)28(39-8)19(4)12-18(3)26(16)40-30(31)36/h9-12,14-16,19-20,24,26-28,33-34H,13H2,1-8H3,(H2,31,36)(H,32,35)/b10-9-,17-11+,18-12+/t16-,19-,20-,24-,26?,27+,28+/m0/s1 |
| InChIKey | SVSFCSOFEPJFSF-AEWVRXHASA-N |
| XLogP | 4.98 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|