C28H42N2O9 — CID 24833819
methanol;[(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate (PubChem CID 24833819) has the molecular formula C28H42N2O9 and a molecular weight of 550.65 g/mol. Its IUPAC name is methanol;[(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | methanol;[(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 24833819 |
| Molecular Formula | C28H42N2O9 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | methanol;[(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
| SMILES | C/C1=C\C=C\C(C)C(OC(N)=O)/C(C)=C/C(C)C(O)C(O)CC(C)C(O)c2cc(O)cc(c2O)NC1=O.CO |
| InChI | InChI=1S/C27H38N2O8.CH4O/c1-13-7-6-8-14(2)26(35)29-20-12-18(30)11-19(24(20)34)22(32)16(4)10-21(31)23(33)15(3)9-17(5)25(13)37-27(28)36;1-2/h6-9,11-13,15-16,21-23,25,30-34H,10H2,1-5H3,(H2,28,36)(H,29,35);2H,1H3/b7-6+,14-8+,17-9+; |
| InChIKey | MDHZYKQJAXANHK-IYNRIPKZSA-N |
| XLogP | 2.62 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|