C29H40N2O7 — CID 20768767
[(4Z,6Z,10Z)-13,17-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 20768767) has the molecular formula C29H40N2O7 and a molecular weight of 528.65 g/mol. Its IUPAC name is [(4Z,6Z,10Z)-13,17-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4Z,6Z,10Z)-13,17-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 20768767 |
| Molecular Formula | C29H40N2O7 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | [(4Z,6Z,10Z)-13,17-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | CC1=C2C(=O)C(=CC1=O)NC(=O)/C(C)=C\C=C/C(C)C(OC(N)=O)/C(C)=C\C(C)C(O)C(C)CC(C)C2O |
| InChI | InChI=1S/C29H40N2O7/c1-14-9-8-10-15(2)28(36)31-21-13-22(32)20(7)23(26(21)35)25(34)18(5)11-16(3)24(33)17(4)12-19(6)27(14)38-29(30)37/h8-10,12-14,16-18,24-25,27,33-34H,11H2,1-7H3,(H2,30,37)(H,31,36)/b9-8-,15-10-,19-12- |
| InChIKey | WEOJGYSWSNMZAA-NAIDCGFBSA-N |
| XLogP | 3.04 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|