C28H40N2O4 — CID 59595794
[(4E,6Z,8S,9R,10E,12S,13S,14S,16S)-13-hydroxy-4,8,10,12,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate (PubChem CID 59595794) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is [(4E,6Z,8S,9R,10E,12S,13S,14S,16S)-13-hydroxy-4,8,10,12,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,8S,9R,10E,12S,13S,14S,16S)-13-hydroxy-4,8,10,12,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 59595794 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | [(4E,6Z,8S,9R,10E,12S,13S,14S,16S)-13-hydroxy-4,8,10,12,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
| SMILES | C/C1=C\C=C/[C@H](C)[C@@H](OC(N)=O)/C(C)=C/[C@H](C)[C@@H](O)[C@@H](C)C[C@H](C)Cc2cccc(c2)NC1=O |
| InChI | InChI=1S/C28H40N2O4/c1-17-13-20(4)25(31)21(5)15-22(6)26(34-28(29)33)18(2)9-7-10-19(3)27(32)30-24-12-8-11-23(14-17)16-24/h7-12,15-18,20-21,25-26,31H,13-14H2,1-6H3,(H2,29,33)(H,30,32)/b9-7-,19-10+,22-15+/t17-,18-,20-,21-,25-,26+/m0/s1 |
| InChIKey | QVBDKKVYMXTIBS-CEYIZTIOSA-N |
| XLogP | 5.39 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|