C28H39NO7 — CID 25007900
[(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-oxabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate (PubChem CID 25007900) has the molecular formula C28H39NO7 and a molecular weight of 501.62 g/mol. Its IUPAC name is [(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-oxabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-oxabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 25007900 |
| Molecular Formula | C28H39NO7 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | [(4E,6Z,10E)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-oxabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
| SMILES | COC1/C=C\C=C(/C)C(=O)Oc2cccc(c2)CC(C)CC(OC)C(O)C(C)/C=C(\C)C1OC(N)=O |
| InChI | InChI=1S/C28H39NO7/c1-17-13-21-10-8-11-22(16-21)35-27(31)18(2)9-7-12-23(33-5)26(36-28(29)32)20(4)15-19(3)25(30)24(14-17)34-6/h7-12,15-17,19,23-26,30H,13-14H2,1-6H3,(H2,29,32)/b12-7-,18-9+,20-15+ |
| InChIKey | FDAATLJKAKCFDH-FHNQFRAHSA-N |
| XLogP | 4.11 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|