C27H38N2O8 — CID 24833820
[(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate (PubChem CID 24833820) has the molecular formula C27H38N2O8 and a molecular weight of 518.61 g/mol. Its IUPAC name is [(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 24833820 |
| Molecular Formula | C27H38N2O8 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | [(4E,6E,10E)-13,14,17,20,22-pentahydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
| SMILES | C/C1=C\C=C\C(C)C(OC(N)=O)/C(C)=C/C(C)C(O)C(O)CC(C)C(O)c2cc(O)cc(c2O)NC1=O |
| InChI | InChI=1S/C27H38N2O8/c1-13-7-6-8-14(2)26(35)29-20-12-18(30)11-19(24(20)34)22(32)16(4)10-21(31)23(33)15(3)9-17(5)25(13)37-27(28)36/h6-9,11-13,15-16,21-23,25,30-34H,10H2,1-5H3,(H2,28,36)(H,29,35)/b7-6+,14-8+,17-9+ |
| InChIKey | FEZZBMOLZCMYHS-FCAQSRQMSA-N |
| XLogP | 3.02 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|