C30H43N3O6 — CID 91015485
[19-(azetidin-1-yl)-13,20,22-trihydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate (PubChem CID 91015485) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is [19-(azetidin-1-yl)-13,20,22-trihydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [19-(azetidin-1-yl)-13,20,22-trihydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 91015485 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | [19-(azetidin-1-yl)-13,20,22-trihydroxy-4,8,10,12,16-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
| SMILES | CC1=CC=CC(C)C(OC(N)=O)C(C)=CC(C)C(O)CCC(C)Cc2c(O)c(cc(O)c2N2CCC2)NC1=O |
| InChI | InChI=1S/C30H43N3O6/c1-17-10-11-24(34)20(4)15-21(5)28(39-30(31)38)18(2)8-6-9-19(3)29(37)32-23-16-25(35)26(33-12-7-13-33)22(14-17)27(23)36/h6,8-9,15-18,20,24,28,34-36H,7,10-14H2,1-5H3,(H2,31,38)(H,32,37) |
| InChIKey | TWAILGSVUADHKU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|