C31H43N3O9 — CID 91052817
[19-(azetidin-1-yl)-13,20,22-trihydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate (PubChem CID 91052817) has the molecular formula C31H43N3O9 and a molecular weight of 601.70 g/mol. Its IUPAC name is [19-(azetidin-1-yl)-13,20,22-trihydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate.
| Compound Name | [19-(azetidin-1-yl)-13,20,22-trihydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate |
|---|---|
| PubChem CID | 91052817 |
| Molecular Formula | C31H43N3O9 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | [19-(azetidin-1-yl)-13,20,22-trihydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate |
| SMILES | COC1C=CC=C(C)C(=O)Nc2cc(O)c(N3CCC3)c(c2O)C=C(C)CC(OC)C(O)C(C)C=C(CO)C1OC(N)=O |
| InChI | InChI=1S/C31H43N3O9/c1-17-12-21-26(34-10-7-11-34)23(36)15-22(28(21)38)33-30(39)18(2)8-6-9-24(41-4)29(43-31(32)40)20(16-35)14-19(3)27(37)25(13-17)42-5/h6,8-9,12,14-15,19,24-25,27,29,35-38H,7,10-11,13,16H2,1-5H3,(H2,32,40)(H,33,39) |
| InChIKey | JOYXOURORJOTMQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|