C31H46N4O6 — CID 20768763
[(4Z,6Z,10Z)-19-[2-(dimethylamino)ethylamino]-13-hydroxy-4,8,10,12,14-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 20768763) has the molecular formula C31H46N4O6 and a molecular weight of 570.73 g/mol. Its IUPAC name is [(4Z,6Z,10Z)-19-[2-(dimethylamino)ethylamino]-13-hydroxy-4,8,10,12,14-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4Z,6Z,10Z)-19-[2-(dimethylamino)ethylamino]-13-hydroxy-4,8,10,12,14-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 20768763 |
| Molecular Formula | C31H46N4O6 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | [(4Z,6Z,10Z)-19-[2-(dimethylamino)ethylamino]-13-hydroxy-4,8,10,12,14-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | C/C1=C/C=C\C(C)C(OC(N)=O)/C(C)=C\C(C)C(O)C(C)CCCC2=C(NCCN(C)C)C(=O)C=C(NC1=O)C2=O |
| InChI | InChI=1S/C31H46N4O6/c1-18-10-9-13-23-26(33-14-15-35(6)7)25(36)17-24(28(23)38)34-30(39)20(3)12-8-11-19(2)29(41-31(32)40)22(5)16-21(4)27(18)37/h8,11-12,16-19,21,27,29,33,37H,9-10,13-15H2,1-7H3,(H2,32,40)(H,34,39)/b11-8-,20-12-,22-16- |
| InChIKey | FCFBNMSQRSVDIA-LBBMIAAWSA-N |
| XLogP | 2.91 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|