C30H46N4O7 — CID 143651288
[(4E,10E,14S)-19-[2-(dimethylamino)ethylamino]-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate (PubChem CID 143651288) has the molecular formula C30H46N4O7 and a molecular weight of 574.72 g/mol. Its IUPAC name is [(4E,10E,14S)-19-[2-(dimethylamino)ethylamino]-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate.
| Compound Name | [(4E,10E,14S)-19-[2-(dimethylamino)ethylamino]-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate |
|---|---|
| PubChem CID | 143651288 |
| Molecular Formula | C30H46N4O7 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | [(4E,10E,14S)-19-[2-(dimethylamino)ethylamino]-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate |
| SMILES | COC1CC/C=C(\C)C(=O)NC2=CC(=O)C(NCCN(C)C)=C(CCC[C@H](OC)CC/C=C(\C)C1OC(N)=O)C2=O |
| InChI | InChI=1S/C30H46N4O7/c1-19-10-7-12-21(39-5)13-9-14-22-26(32-16-17-34(3)4)24(35)18-23(27(22)36)33-29(37)20(2)11-8-15-25(40-6)28(19)41-30(31)38/h10-11,18,21,25,28,32H,7-9,12-17H2,1-6H3,(H2,31,38)(H,33,37)/b19-10+,20-11+/t21-,25?,28?/m1/s1 |
| InChIKey | RUVRRBJQTKVPLA-NXUOUQFUSA-N |
| XLogP | 2.67 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|