C27H36FN3O7 — CID 143693739
[(4E,6Z,10E)-19-(2-fluoroethylamino)-13-hydroxy-8-methoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 143693739) has the molecular formula C27H36FN3O7 and a molecular weight of 533.60 g/mol. Its IUPAC name is [(4E,6Z,10E)-19-(2-fluoroethylamino)-13-hydroxy-8-methoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E)-19-(2-fluoroethylamino)-13-hydroxy-8-methoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 143693739 |
| Molecular Formula | C27H36FN3O7 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | [(4E,6Z,10E)-19-(2-fluoroethylamino)-13-hydroxy-8-methoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | COC1/C=C\C=C(/C)C(=O)NC2=CC(=O)C(NCCF)=C(CCCCC(O)C/C=C(\C)C1OC(N)=O)C2=O |
| InChI | InChI=1S/C27H36FN3O7/c1-16-11-12-18(32)8-4-5-9-19-23(30-14-13-28)21(33)15-20(24(19)34)31-26(35)17(2)7-6-10-22(37-3)25(16)38-27(29)36/h6-7,10-11,15,18,22,25,30,32H,4-5,8-9,12-14H2,1-3H3,(H2,29,36)(H,31,35)/b10-6-,16-11+,17-7+ |
| InChIKey | GTWQOTBWVQPGRS-PLBSCXHASA-N |
| XLogP | 2.20 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|