C26H35N3O7 — CID 143693741
[(4E,6Z,8S,10E,14S)-19-amino-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 143693741) has the molecular formula C26H35N3O7 and a molecular weight of 501.58 g/mol. Its IUPAC name is [(4E,6Z,8S,10E,14S)-19-amino-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,8S,10E,14S)-19-amino-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 143693741 |
| Molecular Formula | C26H35N3O7 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [(4E,6Z,8S,10E,14S)-19-amino-8,14-dimethoxy-4,10-dimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | CO[C@@H]1CC/C=C(\C)C(OC(N)=O)[C@@H](OC)/C=C\C=C(/C)C(=O)NC2=CC(=O)C(N)=C(CCC1)C2=O |
| InChI | InChI=1S/C26H35N3O7/c1-15-8-5-10-17(34-3)11-7-12-18-22(27)20(30)14-19(23(18)31)29-25(32)16(2)9-6-13-21(35-4)24(15)36-26(28)33/h6,8-9,13-14,17,21,24H,5,7,10-12,27H2,1-4H3,(H2,28,33)(H,29,32)/b13-6-,15-8+,16-9+/t17-,21+,24?/m1/s1 |
| InChIKey | VGIHNUKJLNBKGC-KQSUSDQESA-N |
| XLogP | 2.26 |
| TPSA | 160.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|