C26H34N2O7 — CID 143551028
[(4E,6Z,8S,9R,10E,14R,17R)-17-hydroxy-14-methoxy-4,8,10-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 143551028) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is [(4E,6Z,8S,9R,10E,14R,17R)-17-hydroxy-14-methoxy-4,8,10-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,8S,9R,10E,14R,17R)-17-hydroxy-14-methoxy-4,8,10-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 143551028 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [(4E,6Z,8S,9R,10E,14R,17R)-17-hydroxy-14-methoxy-4,8,10-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | CO[C@@H]1CC/C=C(\C)[C@H](OC(N)=O)[C@@H](C)/C=C\C=C(/C)C(=O)NC2=CC(=O)C=C(C2=O)[C@H](O)CC1 |
| InChI | InChI=1S/C26H34N2O7/c1-15-7-5-9-17(3)25(32)28-21-14-18(29)13-20(23(21)31)22(30)12-11-19(34-4)10-6-8-16(2)24(15)35-26(27)33/h5,7-9,13-15,19,22,24,30H,6,10-12H2,1-4H3,(H2,27,33)(H,28,32)/b7-5-,16-8+,17-9+/t15-,19+,22+,24+/m0/s1 |
| InChIKey | MVXLFLMRTXFQKV-SXHXDXKZSA-N |
| XLogP | 2.56 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|