C28H37N3O8 — CID 70836116
[(4E,6Z,10E,16R)-19-amino-8,14-dimethoxy-4,10,12,16-tetramethyl-3,13,20,22-tetraoxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 70836116) has the molecular formula C28H37N3O8 and a molecular weight of 543.62 g/mol. Its IUPAC name is [(4E,6Z,10E,16R)-19-amino-8,14-dimethoxy-4,10,12,16-tetramethyl-3,13,20,22-tetraoxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E,16R)-19-amino-8,14-dimethoxy-4,10,12,16-tetramethyl-3,13,20,22-tetraoxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 70836116 |
| Molecular Formula | C28H37N3O8 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | [(4E,6Z,10E,16R)-19-amino-8,14-dimethoxy-4,10,12,16-tetramethyl-3,13,20,22-tetraoxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | COC1C[C@H](C)CC2=C(N)C(=O)C=C(NC(=O)/C(C)=C/C=C\C(OC)C(OC(N)=O)/C(C)=C/C(C)C1=O)C2=O |
| InChI | InChI=1S/C28H37N3O8/c1-14-10-18-23(29)20(32)13-19(25(18)34)31-27(35)15(2)8-7-9-21(37-5)26(39-28(30)36)17(4)12-16(3)24(33)22(11-14)38-6/h7-9,12-14,16,21-22,26H,10-11,29H2,1-6H3,(H2,30,36)(H,31,35)/b9-7-,15-8+,17-12+/t14-,16?,21?,22?,26?/m1/s1 |
| InChIKey | ZQRLSEVIGUVMEG-KCVSBOFFSA-N |
| XLogP | 1.93 |
| TPSA | 177.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|