C32H46N4O9 — CID 69187429
[9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-13-yl] carbamate (PubChem CID 69187429) has the molecular formula C32H46N4O9 and a molecular weight of 630.74 g/mol. Its IUPAC name is [9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-13-yl] carbamate.
| Compound Name | [9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-13-yl] carbamate |
|---|---|
| PubChem CID | 69187429 |
| Molecular Formula | C32H46N4O9 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | [9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-13-yl] carbamate |
| SMILES | C=CCNC1=C2CC(C)CC(OC)C(OC(N)=O)C(C)C=C(C)C(OC(N)=O)C(OC)CCC=C(C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C32H46N4O9/c1-8-12-35-26-21-13-17(2)14-25(43-7)29(45-32(34)41)20(5)15-19(4)28(44-31(33)40)24(42-6)11-9-10-18(3)30(39)36-22(27(21)38)16-23(26)37/h8,10,15-17,20,24-25,28-29,35H,1,9,11-14H2,2-7H3,(H2,33,40)(H2,34,41)(H,36,39) |
| InChIKey | LMNGMENTSBALNZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 198.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|