C29H42N2O7 — CID 20768770
[(4Z,10Z)-7,13-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate (PubChem CID 20768770) has the molecular formula C29H42N2O7 and a molecular weight of 530.66 g/mol. Its IUPAC name is [(4Z,10Z)-7,13-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate.
| Compound Name | [(4Z,10Z)-7,13-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate |
|---|---|
| PubChem CID | 20768770 |
| Molecular Formula | C29H42N2O7 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | [(4Z,10Z)-7,13-dihydroxy-4,8,10,12,14,16,19-heptamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate |
| SMILES | CC1=C2CC(C)CC(C)C(O)C(C)/C=C(/C)C(OC(N)=O)C(C)C(O)C/C=C(/C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C29H42N2O7/c1-14-10-16(3)25(34)17(4)12-18(5)27(38-29(30)37)20(7)23(32)9-8-15(2)28(36)31-22-13-24(33)19(6)21(11-14)26(22)35/h8,12-14,16-17,20,23,25,27,32,34H,9-11H2,1-7H3,(H2,30,37)(H,31,36)/b15-8-,18-12- |
| InChIKey | IAUFEUOYYKZOJH-PJUMXBBISA-N |
| XLogP | 3.26 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|