C11H17NO — CID 143420173
4,5-dimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydro-1,4-oxazine (PubChem CID 143420173) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4,5-dimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydro-1,4-oxazine.
| Compound Name | 4,5-dimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydro-1,4-oxazine |
|---|---|
| PubChem CID | 143420173 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4,5-dimethyl-6-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydro-1,4-oxazine |
| SMILES | C=C/C(C)=C\C1=C(C)N(C)CCO1 |
| InChI | InChI=1S/C11H17NO/c1-5-9(2)8-11-10(3)12(4)6-7-13-11/h5,8H,1,6-7H2,2-4H3/b9-8- |
| InChIKey | CBWTZNADPYWHFX-HJWRWDBZSA-N |
| XLogP | 2.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|