C12H17NO — CID 142096969
4,7,7-trimethyl-2,3-dihydrocyclohepta[b][1,4]oxazine (PubChem CID 142096969) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4,7,7-trimethyl-2,3-dihydrocyclohepta[b][1,4]oxazine.
| Compound Name | 4,7,7-trimethyl-2,3-dihydrocyclohepta[b][1,4]oxazine |
|---|---|
| PubChem CID | 142096969 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4,7,7-trimethyl-2,3-dihydrocyclohepta[b][1,4]oxazine |
| SMILES | CN1CCOC2=C1C=CC(C)(C)C=C2 |
| InChI | InChI=1S/C12H17NO/c1-12(2)6-4-10-11(5-7-12)14-9-8-13(10)3/h4-7H,8-9H2,1-3H3 |
| InChIKey | XASXITOVAFJYGW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |