C10H16NO+ — CID 59379130
5,5,7,8-tetramethyl-2-oxa-5-azoniabicyclo[4.2.0]octa-1(6),7-diene (PubChem CID 59379130) has the molecular formula C10H16NO+ and a molecular weight of 166.24 g/mol. Its IUPAC name is 5,5,7,8-tetramethyl-2-oxa-5-azoniabicyclo[4.2.0]octa-1(6),7-diene.
| Compound Name | 5,5,7,8-tetramethyl-2-oxa-5-azoniabicyclo[4.2.0]octa-1(6),7-diene |
|---|---|
| PubChem CID | 59379130 |
| Molecular Formula | C10H16NO+ |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 5,5,7,8-tetramethyl-2-oxa-5-azoniabicyclo[4.2.0]octa-1(6),7-diene |
| SMILES | CC1=C(C)C2=C1OCC[N+]2(C)C |
| InChI | InChI=1S/C10H16NO/c1-7-8(2)10-9(7)11(3,4)5-6-12-10/h5-6H2,1-4H3/q+1 |
| InChIKey | OAPZBJCAHKKZOK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|