C18H32N2O — CID 143099774
N-[(Z)-but-2-enyl]-5-[2-(dimethylamino)ethoxy]-N-methylcyclohepta-1,4,6-trien-1-amine;ethane (PubChem CID 143099774) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[(Z)-but-2-enyl]-5-[2-(dimethylamino)ethoxy]-N-methylcyclohepta-1,4,6-trien-1-amine;ethane.
| Compound Name | N-[(Z)-but-2-enyl]-5-[2-(dimethylamino)ethoxy]-N-methylcyclohepta-1,4,6-trien-1-amine;ethane |
|---|---|
| PubChem CID | 143099774 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-[(Z)-but-2-enyl]-5-[2-(dimethylamino)ethoxy]-N-methylcyclohepta-1,4,6-trien-1-amine;ethane |
| SMILES | C/C=C\CN(C)C1=CCC=C(OCCN(C)C)C=C1.CC |
| InChI | InChI=1S/C16H26N2O.C2H6/c1-5-6-12-18(4)15-8-7-9-16(11-10-15)19-14-13-17(2)3;1-2/h5-6,8-11H,7,12-14H2,1-4H3;1-2H3/b6-5-; |
| InChIKey | GBUNCGFBYMQMOT-YSMBQZINSA-N |
| XLogP | 3.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|