C12H17NO2 — CID 142919990
4-(5-methoxycyclohepta-1,4,6-trien-1-yl)morpholine (PubChem CID 142919990) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-(5-methoxycyclohepta-1,4,6-trien-1-yl)morpholine.
| Compound Name | 4-(5-methoxycyclohepta-1,4,6-trien-1-yl)morpholine |
|---|---|
| PubChem CID | 142919990 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-(5-methoxycyclohepta-1,4,6-trien-1-yl)morpholine |
| SMILES | COC1=CCC=C(N2CCOCC2)C=C1 |
| InChI | InChI=1S/C12H17NO2/c1-14-12-4-2-3-11(5-6-12)13-7-9-15-10-8-13/h3-6H,2,7-10H2,1H3 |
| InChIKey | MYMRUJGWDWKSAI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |