C11H17NO — CID 142222903
ethane;2,3,4,7-tetrahydrocyclohepta[b][1,4]oxazine (PubChem CID 142222903) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;2,3,4,7-tetrahydrocyclohepta[b][1,4]oxazine.
| Compound Name | ethane;2,3,4,7-tetrahydrocyclohepta[b][1,4]oxazine |
|---|---|
| PubChem CID | 142222903 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;2,3,4,7-tetrahydrocyclohepta[b][1,4]oxazine |
| SMILES | C1=CC2=C(C=CC1)OCCN2.CC |
| InChI | InChI=1S/C9H11NO.C2H6/c1-2-4-8-9(5-3-1)11-7-6-10-8;1-2/h2-5,10H,1,6-7H2;1-2H3 |
| InChIKey | GYEQYWSMHOZWOS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |