C22H22N6O5 — CID 143421508
methyl 5-methyl-2-[[4-(6-nitroquinoxalin-2-yl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 143421508) has the molecular formula C22H22N6O5 and a molecular weight of 450.46 g/mol. Its IUPAC name is methyl 5-methyl-2-[[4-(6-nitroquinoxalin-2-yl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 5-methyl-2-[[4-(6-nitroquinoxalin-2-yl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 143421508 |
| Molecular Formula | C22H22N6O5 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | methyl 5-methyl-2-[[4-(6-nitroquinoxalin-2-yl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(C)ccc1NC(=O)N1CCN(c2cnc3cc([N+](=O)[O-])ccc3n2)CC1 |
| InChI | InChI=1S/C22H22N6O5/c1-14-3-5-17(16(11-14)21(29)33-2)25-22(30)27-9-7-26(8-10-27)20-13-23-19-12-15(28(31)32)4-6-18(19)24-20/h3-6,11-13H,7-10H2,1-2H3,(H,25,30) |
| InChIKey | HLNHUKOWVKIEJY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|