C19H40N2O — CID 143422571
1,4-dimethylpiperidine;formaldehyde;1-hexylpiperidine (PubChem CID 143422571) has the molecular formula C19H40N2O and a molecular weight of 312.54 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;formaldehyde;1-hexylpiperidine.
| Compound Name | 1,4-dimethylpiperidine;formaldehyde;1-hexylpiperidine |
|---|---|
| PubChem CID | 143422571 |
| Molecular Formula | C19H40N2O |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.31 |
| IUPAC Name | 1,4-dimethylpiperidine;formaldehyde;1-hexylpiperidine |
| SMILES | C=O.CC1CCN(C)CC1.CCCCCCN1CCCCC1 |
| InChI | InChI=1S/C11H23N.C7H15N.CH2O/c1-2-3-4-6-9-12-10-7-5-8-11-12;1-7-3-5-8(2)6-4-7;1-2/h2-11H2,1H3;7H,3-6H2,1-2H3;1H2 |
| InChIKey | ZZSAPPINTACFHM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|