C26H28N4O2 — CID 143424274
1-[2-[2-[amino(propyl)amino]ethyl]quinolin-6-yl]-4-phenylmethoxypyridin-2-one (PubChem CID 143424274) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[2-[2-[amino(propyl)amino]ethyl]quinolin-6-yl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-[2-[2-[amino(propyl)amino]ethyl]quinolin-6-yl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 143424274 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[2-[2-[amino(propyl)amino]ethyl]quinolin-6-yl]-4-phenylmethoxypyridin-2-one |
| SMILES | CCCN(N)CCc1ccc2cc(-n3ccc(OCc4ccccc4)cc3=O)ccc2n1 |
| InChI | InChI=1S/C26H28N4O2/c1-2-14-29(27)15-12-22-9-8-21-17-23(10-11-25(21)28-22)30-16-13-24(18-26(30)31)32-19-20-6-4-3-5-7-20/h3-11,13,16-18H,2,12,14-15,19,27H2,1H3 |
| InChIKey | XEIPCILZVKGUBJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|