C23H21N3O2 — CID 71080950
1-[2-(2-aminoethyl)quinolin-6-yl]-4-phenylmethoxypyridin-2-one (PubChem CID 71080950) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[2-(2-aminoethyl)quinolin-6-yl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-[2-(2-aminoethyl)quinolin-6-yl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 71080950 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[2-(2-aminoethyl)quinolin-6-yl]-4-phenylmethoxypyridin-2-one |
| SMILES | NCCc1ccc2cc(-n3ccc(OCc4ccccc4)cc3=O)ccc2n1 |
| InChI | InChI=1S/C23H21N3O2/c24-12-10-19-7-6-18-14-20(8-9-22(18)25-19)26-13-11-21(15-23(26)27)28-16-17-4-2-1-3-5-17/h1-9,11,13-15H,10,12,16,24H2 |
| InChIKey | BBTNOLVVVDNHNU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |