C16H24N4 — CID 143424336
4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)ethenyl]pyridin-2-amine (PubChem CID 143424336) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)ethenyl]pyridin-2-amine.
| Compound Name | 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)ethenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 143424336 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-[1-(3,9-diazaspiro[5.5]undecan-3-yl)ethenyl]pyridin-2-amine |
| SMILES | C=C(c1ccnc(N)c1)N1CCC2(CCNCC2)CC1 |
| InChI | InChI=1S/C16H24N4/c1-13(14-2-7-19-15(17)12-14)20-10-5-16(6-11-20)3-8-18-9-4-16/h2,7,12,18H,1,3-6,8-11H2,(H2,17,19) |
| InChIKey | WBENMFXLVBAFGO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |